| Research Area |
Other/Reagents |
| Catalog Number |
RE1058 |
| Alternate Name |
2,3-Dimethoxy-5-methyl-6-decyl-1,4-benzoquinone |
| Molecular Weight |
322.44 |
| Molecular Formula |
C₁₉H₃₀O₄ |
| Appearance |
Orange liquid or semisolid |
| InChi |
InChI=1S/C19H30O4/c1-5-6-7-8-9-10-11-12-13-15-14(2)16(20)18(22-3)19(23-4)17(15)21/h5-13H2,1-4H3 |
| MDL Number |
MFCD00083306 |
| Purity |
≥98% |
| Solubility |
DMSO |
| Handling |
Protect from air and light |
| Storage Instruction |
Store at -20°C |
| Usage Statement |
Our products are intended for research use only and are not to be used for other purposes, including but are not limited to in vitro diagnostic uses, ex vivo or in vivo therapeutic uses. |
